/netgear-WNDR4500v2-V1.0.0.60_1.0.38/src/linux/linux-2.6/drivers/video/ |
H A D | acornfb.c | 51 static struct fb_monspecs monspecs[NR_MONTYPES] __initdata = { 668 struct fb_monspecs *monspecs) 685 return (vs >= monspecs->vfmin && vs <= monspecs->vfmax && 686 hs >= monspecs->hfmin && hs <= monspecs->hfmax) ? 0 : -EINVAL; 769 return acornfb_validate_timing(var, &info->monspecs); 1065 fb_info.monspecs.hfmin = simple_strtoul(p, &p, 0); 1067 fb_info.monspecs.hfmax = simple_strtoul(p + 1, &p, 0); 1069 fb_info.monspecs 667 acornfb_validate_timing(struct fb_var_screeninfo *var, struct fb_monspecs *monspecs) argument [all...] |
H A D | fbmon.c | 1177 * A valid info->monspecs, otherwise 'safe numbers' will be used. 1192 * If monspecs are invalid, use values that are enough 1195 if (!info || !info->monspecs.hfmax || !info->monspecs.vfmax || 1196 !info->monspecs.dclkmax || 1197 info->monspecs.hfmax < info->monspecs.hfmin || 1198 info->monspecs.vfmax < info->monspecs.vfmin || 1199 info->monspecs [all...] |
H A D | au1200fb.c | 329 struct fb_monspecs monspecs; /* FB monitor specs */ member in struct:panel_settings 370 .monspecs = { 401 .monspecs = { 431 .monspecs = { 461 .monspecs = { 491 .monspecs = { 521 .monspecs = { 551 .monspecs = { 584 .monspecs = { 617 .monspecs [all...] |
H A D | atafb.c | 1109 fb_info.monspecs.hfmin < f25.f) 1112 f32.left) * fb_info.monspecs.hfmin < f32.f) 1115 fext.left) * fb_info.monspecs.hfmin < fext.f && 1280 if (hfreq > fb_info.monspecs.hfmax && mon_type != F_MON_VGA) { 1287 if (hfreq > fb_info.monspecs.hfmax || hfreq < fb_info.monspecs.hfmin) 1318 if (vfreq > fb_info.monspecs.vfmax && !doubleline && !interlace) { 1322 } else if (vfreq < fb_info.monspecs.vfmin && !interlace && !doubleline) { 1326 } else if (vfreq < fb_info.monspecs.vfmin && doubleline) { 1332 fb_info.monspecs [all...] |
H A D | hgafb.c | 568 info->monspecs.hfmin = 0; 569 info->monspecs.hfmax = 0; 570 info->monspecs.vfmin = 10000; 571 info->monspecs.vfmax = 10000; 572 info->monspecs.dpms = 0;
|
H A D | amba-clcd.c | 395 fb->fb.monspecs.hfmin = 0; 396 fb->fb.monspecs.hfmax = 100000; 397 fb->fb.monspecs.vfmin = 0; 398 fb->fb.monspecs.vfmax = 400; 399 fb->fb.monspecs.dclkmin = 1000000; 400 fb->fb.monspecs.dclkmax = 100000000;
|
H A D | pvr2fb.c | 833 fb_info->monspecs.hfmin = 30000; 834 fb_info->monspecs.hfmax = 70000; 835 fb_info->monspecs.vfmin = 60; 836 fb_info->monspecs.vfmax = 60; 839 fb_info->monspecs.hfmin = 15469; 840 fb_info->monspecs.hfmax = 15781; 841 fb_info->monspecs.vfmin = 49; 842 fb_info->monspecs.vfmax = 51;
|
H A D | atmel_lcdfb.c | 539 memcpy(&info->monspecs, sinfo->default_monspecs, sizeof(info->monspecs)); 557 ret = fb_find_mode(&info->var, info, NULL, info->monspecs.modedb, 558 info->monspecs.modedb_len, info->monspecs.modedb,
|
H A D | neofb.c | 1827 info->monspecs.modedb = kmalloc(sizeof(struct fb_videomode), GFP_KERNEL); 1828 if (!info->monspecs.modedb) 1830 info->monspecs.modedb_len = 1; 1852 memcpy(info->monspecs.modedb, &vesa_modes[3], sizeof(struct fb_videomode)); 1858 memcpy(info->monspecs.modedb, &mode800x480, sizeof(struct fb_videomode)); 1862 memcpy(info->monspecs.modedb, &vesa_modes[8], sizeof(struct fb_videomode)); 1869 memcpy(info->monspecs.modedb, &vesa_modes[13], sizeof(struct fb_videomode)); 1876 memcpy(info->monspecs.modedb, &vesa_modes[20], sizeof(struct fb_videomode)); 1887 memcpy(info->monspecs.modedb, &vesa_modes[3], sizeof(struct fb_videomode)); 2138 info->monspecs [all...] |
H A D | sa1100fb.c | 1304 /* Fake monspecs to fill in fbinfo structure */ 1305 static struct fb_monspecs monspecs __initdata = { 1344 fbi->fb.monspecs = monspecs;
|
H A D | amifb.c | 1204 fb_info.monspecs.vfmin = vmin; 1205 fb_info.monspecs.vfmax = vmax; 1206 fb_info.monspecs.hfmin = hmin; 1207 fb_info.monspecs.hfmax = hmax; 2353 if (fb_info.monspecs.hfmin == 0) { 2354 fb_info.monspecs.hfmin = 15000; 2355 fb_info.monspecs.hfmax = 38000; 2356 fb_info.monspecs.vfmin = 49; 2357 fb_info.monspecs.vfmax = 90;
|
/netgear-WNDR4500v2-V1.0.0.60_1.0.38/src/linux/linux-2.6/drivers/video/i810/ |
H A D | i810_main.c | 1030 info->monspecs.dclkmax = 234000000; 1033 info->monspecs.dclkmax = 229000000; 1037 info->monspecs.dclkmax = 204000000; 1041 info->monspecs.dclkmin = 15000000; 1047 if (!mode_valid && info->monspecs.gtf && 1051 if (!mode_valid && info->monspecs.modedb_len) { 1061 if (!mode_valid && info->monspecs.modedb_len == 0) { 1063 int default_sync = (info->monspecs.hfmin-HFMIN) 1064 |(info->monspecs.hfmax-HFMAX) 1065 |(info->monspecs [all...] |
/netgear-WNDR4500v2-V1.0.0.60_1.0.38/src/linux/linux-2.6/drivers/video/aty/ |
H A D | radeon_monitor.c | 802 fb_edid_to_monspecs(rinfo->mon1_EDID, &info->monspecs); 803 fb_videomode_to_modelist(info->monspecs.modedb, 804 info->monspecs.modedb_len, 806 rinfo->mon1_modedb = info->monspecs.modedb; 807 rinfo->mon1_dbsize = info->monspecs.modedb_len; 854 info->monspecs.modedb, 855 info->monspecs.modedb_len, NULL, 8) != 0) 862 if (!has_default_mode && info->monspecs.modedb != NULL) { 863 struct fb_monspecs *specs = &info->monspecs; 960 * monspecs, w [all...] |
/netgear-WNDR4500v2-V1.0.0.60_1.0.38/src/linux/linux-2.6/arch/avr32/mach-at32ap/ |
H A D | at32ap7000.c | 931 struct fb_monspecs *monspecs; local 936 * Do a deep copy of the fb data, monspecs and modedb. Make 940 monspecs = kmemdup(data->default_monspecs, 942 if (!monspecs) 945 modedb_size = sizeof(struct fb_videomode) * monspecs->modedb_len; 946 modedb = kmemdup(monspecs->modedb, modedb_size, GFP_KERNEL); 949 monspecs->modedb = modedb; 1002 info->default_monspecs = monspecs; 1010 kfree(monspecs);
|
/netgear-WNDR4500v2-V1.0.0.60_1.0.38/src/linux/linux-2.6/drivers/video/nvidia/ |
H A D | nvidia.c | 825 if (!info->monspecs.hfmax || !info->monspecs.vfmax || 826 !info->monspecs.dclkmax || !fb_validate_mode(var, info)) 830 if (!mode_valid && info->monspecs.gtf) { 845 if (!mode_valid && info->monspecs.modedb_len) 1094 struct fb_monspecs *specs = &info->monspecs; 1106 fb_videomode_to_modelist(info->monspecs.modedb, 1107 info->monspecs.modedb_len, &info->modelist); 1146 fb_destroy_modedb(info->monspecs.modedb); 1147 info->monspecs [all...] |
H A D | nv_setup.c | 628 info->monspecs = *monA;
|
/netgear-WNDR4500v2-V1.0.0.60_1.0.38/src/linux/linux-2.6/drivers/video/riva/ |
H A D | fbdev.c | 1159 if (!info->monspecs.vfmax || !info->monspecs.hfmax || 1160 !info->monspecs.dclkmax || !fb_validate_mode(var, info)) 1165 if (!mode_valid && info->monspecs.gtf) { 1178 if (!mode_valid && info->monspecs.modedb_len) 1809 struct fb_monspecs *specs = &info->monspecs; 1820 if (info->monspecs.misc & FB_MISC_1ST_DETAIL) { 1859 fb_edid_to_monspecs(par->EDID, &info->monspecs); 1860 fb_videomode_to_modelist(info->monspecs.modedb, info->monspecs [all...] |
/netgear-WNDR4500v2-V1.0.0.60_1.0.38/src/linux/linux-2.6/drivers/video/savage/ |
H A D | savagefb_driver.c | 908 if (!info->monspecs.hfmax || !info->monspecs.vfmax || 909 !info->monspecs.dclkmax || !fb_validate_mode(var, info)) 913 if (!mode_valid && info->monspecs.gtf) { 928 if (!mode_valid && info->monspecs.modedb_len) 2247 fb_edid_to_monspecs(par->edid, &info->monspecs); 2249 fb_videomode_to_modelist(info->monspecs.modedb, 2250 info->monspecs.modedb_len, 2257 info->monspecs.modedb, info->monspecs [all...] |
/netgear-WNDR4500v2-V1.0.0.60_1.0.38/src/linux/linux-2.6/drivers/video/matrox/ |
H A D | matroxfb_base.c | 1741 ACCESS_FBINFO(fbcon.monspecs.hfmin) = 0; 1742 ACCESS_FBINFO(fbcon.monspecs.hfmax) = fh; 1743 ACCESS_FBINFO(fbcon.monspecs.vfmin) = 0; 1744 ACCESS_FBINFO(fbcon.monspecs.vfmax) = fv; 1745 ACCESS_FBINFO(fbcon.monspecs.dpms) = 0; /* TBD */
|
/netgear-WNDR4500v2-V1.0.0.60_1.0.38/src/linux/linux-2.6/drivers/video/intelfb/ |
H A D | intelfbdrv.c | 978 &dinfo->info->monspecs); 987 dinfo->info->monspecs.modedb, 988 dinfo->info->monspecs.modedb_len,
|
/netgear-WNDR4500v2-V1.0.0.60_1.0.38/src/linux/linux-2.6/include/linux/ |
H A D | fb.h | 794 struct fb_monspecs monspecs; /* Current Monitor specs */ member in struct:fb_info
|